C13H18BrNO4 — CID 171892929
ethyl 2-amino-5-(4-bromo-1,2-dihydroxybutyl)benzoate (PubChem CID 171892929) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is ethyl 2-amino-5-(4-bromo-1,2-dihydroxybutyl)benzoate.
| Compound Name | ethyl 2-amino-5-(4-bromo-1,2-dihydroxybutyl)benzoate |
|---|---|
| PubChem CID | 171892929 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | ethyl 2-amino-5-(4-bromo-1,2-dihydroxybutyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(O)C(O)CCBr)ccc1N |
| InChI | InChI=1S/C13H18BrNO4/c1-2-19-13(18)9-7-8(3-4-10(9)15)12(17)11(16)5-6-14/h3-4,7,11-12,16-17H,2,5-6,15H2,1H3 |
| InChIKey | ZSMFSQLPCDRWNI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|