C14H22N2O4 — CID 171891137
ethyl 2-amino-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate (PubChem CID 171891137) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 2-amino-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate.
| Compound Name | ethyl 2-amino-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate |
|---|---|
| PubChem CID | 171891137 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | ethyl 2-amino-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate |
| SMILES | CCOC(=O)c1cc(C(O)C(O)CCNC)ccc1N |
| InChI | InChI=1S/C14H22N2O4/c1-3-20-14(19)10-8-9(4-5-11(10)15)13(18)12(17)6-7-16-2/h4-5,8,12-13,16-18H,3,6-7,15H2,1-2H3 |
| InChIKey | KRBKEAHMYNRDKT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|