C12H21N3O2 — CID 171890195
1-(3,4-diamino-5-methylphenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171890195) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-(3,4-diamino-5-methylphenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(3,4-diamino-5-methylphenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171890195 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1-(3,4-diamino-5-methylphenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(C)c(N)c(N)c1 |
| InChI | InChI=1S/C12H21N3O2/c1-7-5-8(6-9(13)11(7)14)12(17)10(16)3-4-15-2/h5-6,10,12,15-17H,3-4,13-14H2,1-2H3 |
| InChIKey | VSMVZZUGDRJQBR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|