C13H19ClN2O4 — CID 171891383
methyl 2-amino-4-chloro-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate (PubChem CID 171891383) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is methyl 2-amino-4-chloro-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate.
| Compound Name | methyl 2-amino-4-chloro-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate |
|---|---|
| PubChem CID | 171891383 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | methyl 2-amino-4-chloro-5-[1,2-dihydroxy-4-(methylamino)butyl]benzoate |
| SMILES | CNCCC(O)C(O)c1cc(C(=O)OC)c(N)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O4/c1-16-4-3-11(17)12(18)7-5-8(13(19)20-2)10(15)6-9(7)14/h5-6,11-12,16-18H,3-4,15H2,1-2H3 |
| InChIKey | RORRXTMRNQYGFO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|