C12H17ClN2O4 — CID 171882423
methyl 2-amino-5-(4-amino-1,2-dihydroxybutyl)-4-chlorobenzoate (PubChem CID 171882423) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is methyl 2-amino-5-(4-amino-1,2-dihydroxybutyl)-4-chlorobenzoate.
| Compound Name | methyl 2-amino-5-(4-amino-1,2-dihydroxybutyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 171882423 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl 2-amino-5-(4-amino-1,2-dihydroxybutyl)-4-chlorobenzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCN)c(Cl)cc1N |
| InChI | InChI=1S/C12H17ClN2O4/c1-19-12(18)7-4-6(8(13)5-9(7)15)11(17)10(16)2-3-14/h4-5,10-11,16-17H,2-3,14-15H2,1H3 |
| InChIKey | JBNKMRMBQRKGRT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|