C10H15ClN2O2 — CID 171880949
4-amino-1-(4-amino-2-chlorophenyl)butane-1,2-diol (PubChem CID 171880949) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 4-amino-1-(4-amino-2-chlorophenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(4-amino-2-chlorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880949 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-amino-1-(4-amino-2-chlorophenyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C10H15ClN2O2/c11-8-5-6(13)1-2-7(8)10(15)9(14)3-4-12/h1-2,5,9-10,14-15H,3-4,12-13H2 |
| InChIKey | HCFUPOIUQLLGAF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|