C8H8Cl3NO — CID 2317253
(1R)-1-(4-amino-2-chlorophenyl)-2,2-dichloroethanol (PubChem CID 2317253) has the molecular formula C8H8Cl3NO and a molecular weight of 240.52 g/mol. Its IUPAC name is (1R)-1-(4-amino-2-chlorophenyl)-2,2-dichloroethanol.
| Compound Name | (1R)-1-(4-amino-2-chlorophenyl)-2,2-dichloroethanol |
|---|---|
| PubChem CID | 2317253 |
| Molecular Formula | C8H8Cl3NO |
| Molecular Weight | 240.52 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | (1R)-1-(4-amino-2-chlorophenyl)-2,2-dichloroethanol |
| SMILES | Nc1ccc([C@@H](O)C(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl3NO/c9-6-3-4(12)1-2-5(6)7(13)8(10)11/h1-3,7-8,13H,12H2/t7-/m1/s1 |
| InChIKey | YJJQMDVRCASGGQ-SSDOTTSWSA-N |
| XLogP | 2.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|