C10H13Cl2NO2 — CID 171880819
4-amino-1-(2,4-dichlorophenyl)butane-1,2-diol (PubChem CID 171880819) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is 4-amino-1-(2,4-dichlorophenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(2,4-dichlorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880819 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 4-amino-1-(2,4-dichlorophenyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2/c11-6-1-2-7(8(12)5-6)10(15)9(14)3-4-13/h1-2,5,9-10,14-15H,3-4,13H2 |
| InChIKey | ZBMHLXSUWAMEGY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |