C11H15ClFNO2 — CID 171881103
4-amino-1-(2-chloro-4-fluoro-3-methylphenyl)butane-1,2-diol (PubChem CID 171881103) has the molecular formula C11H15ClFNO2 and a molecular weight of 247.70 g/mol. Its IUPAC name is 4-amino-1-(2-chloro-4-fluoro-3-methylphenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(2-chloro-4-fluoro-3-methylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881103 |
| Molecular Formula | C11H15ClFNO2 |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-amino-1-(2-chloro-4-fluoro-3-methylphenyl)butane-1,2-diol |
| SMILES | Cc1c(F)ccc(C(O)C(O)CCN)c1Cl |
| InChI | InChI=1S/C11H15ClFNO2/c1-6-8(13)3-2-7(10(6)12)11(16)9(15)4-5-14/h2-3,9,11,15-16H,4-5,14H2,1H3 |
| InChIKey | LLZBFVQPMDYFRL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |