C11H14FNO4 — CID 171881539
2-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzoic acid (PubChem CID 171881539) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is 2-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzoic acid.
| Compound Name | 2-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 171881539 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzoic acid |
| SMILES | NCCC(O)C(O)c1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C11H14FNO4/c12-6-1-2-7(8(5-6)11(16)17)10(15)9(14)3-4-13/h1-2,5,9-10,14-15H,3-4,13H2,(H,16,17) |
| InChIKey | YXXNHFBWNGQOGN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |