C12H15FO3S — CID 171874421
1-[2-(1,2-dihydroxy-4-sulfanylbutyl)-5-fluorophenyl]ethanone (PubChem CID 171874421) has the molecular formula C12H15FO3S and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-[2-(1,2-dihydroxy-4-sulfanylbutyl)-5-fluorophenyl]ethanone.
| Compound Name | 1-[2-(1,2-dihydroxy-4-sulfanylbutyl)-5-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 171874421 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-[2-(1,2-dihydroxy-4-sulfanylbutyl)-5-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(F)ccc1C(O)C(O)CCS |
| InChI | InChI=1S/C12H15FO3S/c1-7(14)10-6-8(13)2-3-9(10)12(16)11(15)4-5-17/h2-3,6,11-12,15-17H,4-5H2,1H3 |
| InChIKey | DJELZVBZHAQZBQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|