C11H14BrNO4 — CID 171882394
2-(4-amino-1,2-dihydroxybutyl)-4-bromobenzoic acid (PubChem CID 171882394) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 2-(4-amino-1,2-dihydroxybutyl)-4-bromobenzoic acid.
| Compound Name | 2-(4-amino-1,2-dihydroxybutyl)-4-bromobenzoic acid |
|---|---|
| PubChem CID | 171882394 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-(4-amino-1,2-dihydroxybutyl)-4-bromobenzoic acid |
| SMILES | NCCC(O)C(O)c1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C11H14BrNO4/c12-6-1-2-7(11(16)17)8(5-6)10(15)9(14)3-4-13/h1-2,5,9-10,14-15H,3-4,13H2,(H,16,17) |
| InChIKey | MCDSTEXOGMOOFW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |