C11H16N2O3 — CID 171882384
2-(4-amino-1,2-dihydroxybutyl)benzamide (PubChem CID 171882384) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(4-amino-1,2-dihydroxybutyl)benzamide.
| Compound Name | 2-(4-amino-1,2-dihydroxybutyl)benzamide |
|---|---|
| PubChem CID | 171882384 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(4-amino-1,2-dihydroxybutyl)benzamide |
| SMILES | NCCC(O)C(O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C11H16N2O3/c12-6-5-9(14)10(15)7-3-1-2-4-8(7)11(13)16/h1-4,9-10,14-15H,5-6,12H2,(H2,13,16) |
| InChIKey | KMBJAWJDWNTNHT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |