C11H15NO4 — CID 171881130
2-(4-amino-1,2-dihydroxybutyl)benzoic acid (PubChem CID 171881130) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(4-amino-1,2-dihydroxybutyl)benzoic acid.
| Compound Name | 2-(4-amino-1,2-dihydroxybutyl)benzoic acid |
|---|---|
| PubChem CID | 171881130 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(4-amino-1,2-dihydroxybutyl)benzoic acid |
| SMILES | NCCC(O)C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H15NO4/c12-6-5-9(13)10(14)7-3-1-2-4-8(7)11(15)16/h1-4,9-10,13-14H,5-6,12H2,(H,15,16) |
| InChIKey | PLYRXSUDWJFGEZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |