2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid

C10H14N2O4 — CID 171881352

IUPAC2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid
SMILESNCCC(O)C(O)c1ncccc1C(=O)O
InChIInChI=1S/C10H14N2O4/c11-4-3-7(13)9(14)8-6(10(15)16)2-1-5-12-8/h1-2,5,7,9,13-14H,3-4,11H2,(H,15,16)
InChIKeyAXMGCMNKHKRLEQ-UHFFFAOYSA-N
MW226.23 g/mol
LogP-0.48
Rot. Bonds5

About 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid

2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid (PubChem CID 171881352) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid
PubChem CID171881352
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid
SMILESNCCC(O)C(O)c1ncccc1C(=O)O
InChIInChI=1S/C10H14N2O4/c11-4-3-7(13)9(14)8-6(10(15)16)2-1-5-12-8/h1-2,5,7,9,13-14H,3-4,11H2,(H,15,16)
InChIKeyAXMGCMNKHKRLEQ-UHFFFAOYSA-N
XLogP-0.48
TPSA116.67 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 5-0.48
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid?
The IUPAC name of 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid (CID 171881352) is 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid?
The canonical SMILES for 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid is NCCC(O)C(O)c1ncccc1C(=O)O.
What is the InChIKey of 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid?
The InChIKey is AXMGCMNKHKRLEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c11-4-3-7(13)9(14)8-6(10(15)16)2-1-5-12-8/h1-2,5,7,9,13-14H,3-4,11H2,(H,15,16).
What are the key properties of 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid?
2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid has a molecular weight of 226.23 g/mol, XLogP of -0.48, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-1,2-dihydroxybutyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 171881352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).