C9H9NO6 — CID 170824061
2-(2-carboxy-1,2-dihydroxyethyl)pyridine-3-carboxylic acid (PubChem CID 170824061) has the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. Its IUPAC name is 2-(2-carboxy-1,2-dihydroxyethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(2-carboxy-1,2-dihydroxyethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170824061 |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-(2-carboxy-1,2-dihydroxyethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H9NO6/c11-6(7(12)9(15)16)5-4(8(13)14)2-1-3-10-5/h1-3,6-7,11-12H,(H,13,14)(H,15,16) |
| InChIKey | XREYYBQHIRYRQR-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |