2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid

C9H8N2O4 — CID 171870325

IUPAC2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid
SMILESN#CC(O)C(O)c1ncccc1C(=O)O
InChIInChI=1S/C9H8N2O4/c10-4-6(12)8(13)7-5(9(14)15)2-1-3-11-7/h1-3,6,8,12-13H,(H,14,15)
InChIKeyUIDBCTIVWWECBN-UHFFFAOYSA-N
MW208.17 g/mol
LogP-0.30
Rot. Bonds3

About 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid

2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid (PubChem CID 171870325) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid
PubChem CID171870325
Molecular FormulaC9H8N2O4
Molecular Weight208.17 g/mol
Exact Mass208.05
IUPAC Name2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid
SMILESN#CC(O)C(O)c1ncccc1C(=O)O
InChIInChI=1S/C9H8N2O4/c10-4-6(12)8(13)7-5(9(14)15)2-1-3-11-7/h1-3,6,8,12-13H,(H,14,15)
InChIKeyUIDBCTIVWWECBN-UHFFFAOYSA-N
XLogP-0.30
TPSA114.44 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.17
LogP ≤ 5-0.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanohydrins', 'substructure': 'N/A'}

Analyze 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid?
The IUPAC name of 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid (CID 171870325) is 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid?
The canonical SMILES for 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid is N#CC(O)C(O)c1ncccc1C(=O)O.
What is the InChIKey of 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid?
The InChIKey is UIDBCTIVWWECBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c10-4-6(12)8(13)7-5(9(14)15)2-1-3-11-7/h1-3,6,8,12-13H,(H,14,15).
What are the key properties of 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid?
2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid has a molecular weight of 208.17 g/mol, XLogP of -0.30, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyano-1,2-dihydroxyethyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 171870325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).