C8H8N2O3 — CID 171869735
2,3-dihydroxy-3-(3-hydroxy-2-pyridinyl)propanenitrile (PubChem CID 171869735) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3-hydroxy-2-pyridinyl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(3-hydroxy-2-pyridinyl)propanenitrile |
|---|---|
| PubChem CID | 171869735 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2,3-dihydroxy-3-(3-hydroxy-2-pyridinyl)propanenitrile |
| SMILES | N#CC(O)C(O)c1ncccc1O |
| InChI | InChI=1S/C8H8N2O3/c9-4-6(12)8(13)7-5(11)2-1-3-10-7/h1-3,6,8,11-13H |
| InChIKey | JWZJKZWIVSWEIX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|