C9H9ClN2O2 — CID 171900436
4-(3-chloro-2-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900436) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 4-(3-chloro-2-pyridinyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(3-chloro-2-pyridinyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900436 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-(3-chloro-2-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ncccc1Cl |
| InChI | InChI=1S/C9H9ClN2O2/c10-6-2-1-5-12-8(6)9(14)7(13)3-4-11/h1-2,5,7,9,13-14H,3H2 |
| InChIKey | WPBYFUACHZUCQE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |