C9H8Cl2N2O2 — CID 171900710
4-(3,5-dichloro-4-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900710) has the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.08 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-pyridinyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(3,5-dichloro-4-pyridinyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900710 |
| Molecular Formula | C9H8Cl2N2O2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 4-(3,5-dichloro-4-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C9H8Cl2N2O2/c10-5-3-13-4-6(11)8(5)9(15)7(14)1-2-12/h3-4,7,9,14-15H,1H2 |
| InChIKey | KZOWTDSWVUDVDA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |