C11H9ClN2O2 — CID 171900994
2-chloro-4-(3-cyano-1,2-dihydroxypropyl)benzonitrile (PubChem CID 171900994) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is 2-chloro-4-(3-cyano-1,2-dihydroxypropyl)benzonitrile.
| Compound Name | 2-chloro-4-(3-cyano-1,2-dihydroxypropyl)benzonitrile |
|---|---|
| PubChem CID | 171900994 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-chloro-4-(3-cyano-1,2-dihydroxypropyl)benzonitrile |
| SMILES | N#CCC(O)C(O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C11H9ClN2O2/c12-9-5-7(1-2-8(9)6-14)11(16)10(15)3-4-13/h1-2,5,10-11,15-16H,3H2 |
| InChIKey | WHRJLRGBRSZBDD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |