C9H8ClFN2O2 — CID 171900712
4-(5-chloro-6-fluoro-3-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900712) has the molecular formula C9H8ClFN2O2 and a molecular weight of 230.63 g/mol. Its IUPAC name is 4-(5-chloro-6-fluoro-3-pyridinyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(5-chloro-6-fluoro-3-pyridinyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900712 |
| Molecular Formula | C9H8ClFN2O2 |
| Molecular Weight | 230.63 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 4-(5-chloro-6-fluoro-3-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cnc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClFN2O2/c10-6-3-5(4-13-9(6)11)8(15)7(14)1-2-12/h3-4,7-8,14-15H,1H2 |
| InChIKey | LRIHVYVJPXHIBY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.63 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|