C10H8Cl2FNO2 — CID 171900790
4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900790) has the molecular formula C10H8Cl2FNO2 and a molecular weight of 264.08 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900790 |
| Molecular Formula | C10H8Cl2FNO2 |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 4-(3,5-dichloro-4-fluorophenyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2FNO2/c11-6-3-5(4-7(12)9(6)13)10(16)8(15)1-2-14/h3-4,8,10,15-16H,1H2 |
| InChIKey | CCNKDMZRASOYAM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|