C10H9ClFNO2 — CID 171900532
4-(2-chloro-6-fluorophenyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900532) has the molecular formula C10H9ClFNO2 and a molecular weight of 229.64 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900532 |
| Molecular Formula | C10H9ClFNO2 |
| Molecular Weight | 229.64 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H9ClFNO2/c11-6-2-1-3-7(12)9(6)10(15)8(14)4-5-13/h1-3,8,10,14-15H,4H2 |
| InChIKey | KIMCUTVTVJLAGJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.64 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |