C9H7F2NO — CID 79118056
3-(2,6-difluorophenyl)-3-hydroxypropanenitrile (PubChem CID 79118056) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-3-hydroxypropanenitrile.
| Compound Name | 3-(2,6-difluorophenyl)-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 79118056 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-(2,6-difluorophenyl)-3-hydroxypropanenitrile |
| SMILES | N#CCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C9H7F2NO/c10-6-2-1-3-7(11)9(6)8(13)4-5-12/h1-3,8,13H,4H2 |
| InChIKey | MFWUYMMFKXPLDX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |