C11H12FNO — CID 82111982
4-(2-fluorophenyl)-4-hydroxy-3-methylbutanenitrile (PubChem CID 82111982) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-4-hydroxy-3-methylbutanenitrile.
| Compound Name | 4-(2-fluorophenyl)-4-hydroxy-3-methylbutanenitrile |
|---|---|
| PubChem CID | 82111982 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 4-(2-fluorophenyl)-4-hydroxy-3-methylbutanenitrile |
| SMILES | CC(CC#N)C(O)c1ccccc1F |
| InChI | InChI=1S/C11H12FNO/c1-8(6-7-13)11(14)9-4-2-3-5-10(9)12/h2-5,8,11,14H,6H2,1H3 |
| InChIKey | LIGNTBXENBJZJG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |