C12H17FO2 — CID 103457269
1-(2-fluorophenyl)-3,3-dimethylbutane-1,2-diol (PubChem CID 103457269) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3,3-dimethylbutane-1,2-diol.
| Compound Name | 1-(2-fluorophenyl)-3,3-dimethylbutane-1,2-diol |
|---|---|
| PubChem CID | 103457269 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3,3-dimethylbutane-1,2-diol |
| SMILES | CC(C)(C)C(O)C(O)c1ccccc1F |
| InChI | InChI=1S/C12H17FO2/c1-12(2,3)11(15)10(14)8-6-4-5-7-9(8)13/h4-7,10-11,14-15H,1-3H3 |
| InChIKey | FXVCRQGPMYHNEI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |