C12H16BrFO2 — CID 106645237
1-(3-bromo-2-fluorophenyl)-3,3-dimethylbutane-1,2-diol (PubChem CID 106645237) has the molecular formula C12H16BrFO2 and a molecular weight of 291.16 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-3,3-dimethylbutane-1,2-diol.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-3,3-dimethylbutane-1,2-diol |
|---|---|
| PubChem CID | 106645237 |
| Molecular Formula | C12H16BrFO2 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-3,3-dimethylbutane-1,2-diol |
| SMILES | CC(C)(C)C(O)C(O)c1cccc(Br)c1F |
| InChI | InChI=1S/C12H16BrFO2/c1-12(2,3)11(16)10(15)7-5-4-6-8(13)9(7)14/h4-6,10-11,15-16H,1-3H3 |
| InChIKey | PIPDVBWPHXBHPP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |