C15H23BrFNO — CID 106645113
1-(3-bromo-2-fluorophenyl)-2-(diethylamino)-2-methylbutan-1-ol (PubChem CID 106645113) has the molecular formula C15H23BrFNO and a molecular weight of 332.26 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-2-(diethylamino)-2-methylbutan-1-ol.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-2-(diethylamino)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 106645113 |
| Molecular Formula | C15H23BrFNO |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-2-(diethylamino)-2-methylbutan-1-ol |
| SMILES | CCN(CC)C(C)(CC)C(O)c1cccc(Br)c1F |
| InChI | InChI=1S/C15H23BrFNO/c1-5-15(4,18(6-2)7-3)14(19)11-9-8-10-12(16)13(11)17/h8-10,14,19H,5-7H2,1-4H3 |
| InChIKey | AQYPTKBBGCQWOK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |