C15H22F3NO — CID 79063813
2-(diethylamino)-2-methyl-1-(2,3,4-trifluorophenyl)butan-1-ol (PubChem CID 79063813) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-(diethylamino)-2-methyl-1-(2,3,4-trifluorophenyl)butan-1-ol.
| Compound Name | 2-(diethylamino)-2-methyl-1-(2,3,4-trifluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 79063813 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-(diethylamino)-2-methyl-1-(2,3,4-trifluorophenyl)butan-1-ol |
| SMILES | CCN(CC)C(C)(CC)C(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H22F3NO/c1-5-15(4,19(6-2)7-3)14(20)10-8-9-11(16)13(18)12(10)17/h8-9,14,20H,5-7H2,1-4H3 |
| InChIKey | XZSQGUJFRHEMEL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|