C12H18BrNO2 — CID 171261889
2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-6-bromophenol (PubChem CID 171261889) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-6-bromophenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-6-bromophenol |
|---|---|
| PubChem CID | 171261889 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-6-bromophenol |
| SMILES | CC(C)(C)[C@H](O)[C@H](N)c1cccc(Br)c1O |
| InChI | InChI=1S/C12H18BrNO2/c1-12(2,3)11(16)9(14)7-5-4-6-8(13)10(7)15/h4-6,9,11,15-16H,14H2,1-3H3/t9-,11-/m1/s1 |
| InChIKey | WPHMKMXLQDNQGK-MWLCHTKSSA-N |
| XLogP | 2.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|