C12H18BrNO2 — CID 171267578
2-[(1S,2R)-1-amino-2-hydroxyhexyl]-6-bromophenol (PubChem CID 171267578) has the molecular formula C12H18BrNO2 and a molecular weight of 288.18 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-6-bromophenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-6-bromophenol |
|---|---|
| PubChem CID | 171267578 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-6-bromophenol |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1cccc(Br)c1O |
| InChI | InChI=1S/C12H18BrNO2/c1-2-3-7-10(15)11(14)8-5-4-6-9(13)12(8)16/h4-6,10-11,15-16H,2-3,7,14H2,1H3/t10-,11+/m1/s1 |
| InChIKey | DCVKIMYEWLOGLA-MNOVXSKESA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|