C12H17BrClNO — CID 171267713
(1S,2R)-1-amino-1-(2-bromo-5-chlorophenyl)hexan-2-ol (PubChem CID 171267713) has the molecular formula C12H17BrClNO and a molecular weight of 306.63 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2-bromo-5-chlorophenyl)hexan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2-bromo-5-chlorophenyl)hexan-2-ol |
|---|---|
| PubChem CID | 171267713 |
| Molecular Formula | C12H17BrClNO |
| Molecular Weight | 306.63 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | (1S,2R)-1-amino-1-(2-bromo-5-chlorophenyl)hexan-2-ol |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C12H17BrClNO/c1-2-3-4-11(16)12(15)9-7-8(14)5-6-10(9)13/h5-7,11-12,16H,2-4,15H2,1H3/t11-,12+/m1/s1 |
| InChIKey | SIWCSAJREAFDPI-NEPJUHHUSA-N |
| XLogP | 3.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |