C12H17BrClF2NO — CID 171268162
(1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol;hydrochloride (PubChem CID 171268162) has the molecular formula C12H17BrClF2NO and a molecular weight of 344.63 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171268162 |
| Molecular Formula | C12H17BrClF2NO |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | (1S,2R)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol;hydrochloride |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1c(F)ccc(Br)c1F.Cl |
| InChI | InChI=1S/C12H16BrF2NO.ClH/c1-2-3-4-9(17)12(16)10-8(14)6-5-7(13)11(10)15;/h5-6,9,12,17H,2-4,16H2,1H3;1H/t9-,12-;/m1./s1 |
| InChIKey | APQVBONZVROYBJ-WYUVZMMLSA-N |
| XLogP | 3.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|