C16H23BrF2O — CID 106945067
1-(3-bromo-2,6-difluorophenyl)decan-1-ol (PubChem CID 106945067) has the molecular formula C16H23BrF2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)decan-1-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)decan-1-ol |
|---|---|
| PubChem CID | 106945067 |
| Molecular Formula | C16H23BrF2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)decan-1-ol |
| SMILES | CCCCCCCCCC(O)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C16H23BrF2O/c1-2-3-4-5-6-7-8-9-14(20)15-13(18)11-10-12(17)16(15)19/h10-11,14,20H,2-9H2,1H3 |
| InChIKey | UUTOCXNFLKEMAS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|