C9H9Br2FO — CID 118658154
1-(3,6-dibromo-2-fluorophenyl)propan-1-ol (PubChem CID 118658154) has the molecular formula C9H9Br2FO and a molecular weight of 311.98 g/mol. Its IUPAC name is 1-(3,6-dibromo-2-fluorophenyl)propan-1-ol.
| Compound Name | 1-(3,6-dibromo-2-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 118658154 |
| Molecular Formula | C9H9Br2FO |
| Molecular Weight | 311.98 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 1-(3,6-dibromo-2-fluorophenyl)propan-1-ol |
| SMILES | CCC(O)c1c(Br)ccc(Br)c1F |
| InChI | InChI=1S/C9H9Br2FO/c1-2-7(13)8-5(10)3-4-6(11)9(8)12/h3-4,7,13H,2H2,1H3 |
| InChIKey | PPDPSASPGWVXQG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.98 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|