C9H8BrCl2FO — CID 164892359
1-(6-bromo-2-fluoro-3-methylphenyl)-2,2-dichloroethanol (PubChem CID 164892359) has the molecular formula C9H8BrCl2FO and a molecular weight of 301.97 g/mol. Its IUPAC name is 1-(6-bromo-2-fluoro-3-methylphenyl)-2,2-dichloroethanol.
| Compound Name | 1-(6-bromo-2-fluoro-3-methylphenyl)-2,2-dichloroethanol |
|---|---|
| PubChem CID | 164892359 |
| Molecular Formula | C9H8BrCl2FO |
| Molecular Weight | 301.97 g/mol |
| Exact Mass | 299.91 |
| IUPAC Name | 1-(6-bromo-2-fluoro-3-methylphenyl)-2,2-dichloroethanol |
| SMILES | Cc1ccc(Br)c(C(O)C(Cl)Cl)c1F |
| InChI | InChI=1S/C9H8BrCl2FO/c1-4-2-3-5(10)6(7(4)13)8(14)9(11)12/h2-3,8-9,14H,1H3 |
| InChIKey | YKHGGZIJRNQFEX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|