C15H22BrF2N — CID 106945022
1-(3-bromo-2,6-difluorophenyl)-N-ethylheptan-1-amine (PubChem CID 106945022) has the molecular formula C15H22BrF2N and a molecular weight of 334.25 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-ethylheptan-1-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethylheptan-1-amine |
|---|---|
| PubChem CID | 106945022 |
| Molecular Formula | C15H22BrF2N |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethylheptan-1-amine |
| SMILES | CCCCCCC(NCC)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H22BrF2N/c1-3-5-6-7-8-13(19-4-2)14-12(17)10-9-11(16)15(14)18/h9-10,13,19H,3-8H2,1-2H3 |
| InChIKey | JCGZZLPSJDNMHF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|