C16H25BrF2N2 — CID 106942768
1-(3-bromo-2,6-difluorophenyl)-N',N'-diethyl-N-propylpropane-1,3-diamine (PubChem CID 106942768) has the molecular formula C16H25BrF2N2 and a molecular weight of 363.29 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N',N'-diethyl-N-propylpropane-1,3-diamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N',N'-diethyl-N-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106942768 |
| Molecular Formula | C16H25BrF2N2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N',N'-diethyl-N-propylpropane-1,3-diamine |
| SMILES | CCCNC(CCN(CC)CC)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C16H25BrF2N2/c1-4-10-20-14(9-11-21(5-2)6-3)15-13(18)8-7-12(17)16(15)19/h7-8,14,20H,4-6,9-11H2,1-3H3 |
| InChIKey | RXIJBWFQLVYIIV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|