C13H14BrF2N3S — CID 106944775
N-[(3-bromo-2,6-difluorophenyl)-(4-methylthiadiazol-5-yl)methyl]propan-1-amine (PubChem CID 106944775) has the molecular formula C13H14BrF2N3S and a molecular weight of 362.24 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)-(4-methylthiadiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)-(4-methylthiadiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106944775 |
| Molecular Formula | C13H14BrF2N3S |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)-(4-methylthiadiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1snnc1C)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H14BrF2N3S/c1-3-6-17-12(13-7(2)18-19-20-13)10-9(15)5-4-8(14)11(10)16/h4-5,12,17H,3,6H2,1-2H3 |
| InChIKey | LLNMLAOEWZPTHY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|