C14H16BrF2N3 — CID 106942976
N-[(3-bromo-2,6-difluorophenyl)-(3-methylimidazol-4-yl)methyl]propan-1-amine (PubChem CID 106942976) has the molecular formula C14H16BrF2N3 and a molecular weight of 344.20 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)-(3-methylimidazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)-(3-methylimidazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106942976 |
| Molecular Formula | C14H16BrF2N3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)-(3-methylimidazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1c(F)ccc(Br)c1F)c1cncn1C |
| InChI | InChI=1S/C14H16BrF2N3/c1-3-6-19-14(11-7-18-8-20(11)2)12-10(16)5-4-9(15)13(12)17/h4-5,7-8,14,19H,3,6H2,1-2H3 |
| InChIKey | AIOYIMHKLJXWDE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|