C13H14BrF2N3 — CID 106942577
N-[(3-bromo-2,6-difluorophenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine (PubChem CID 106942577) has the molecular formula C13H14BrF2N3 and a molecular weight of 330.18 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106942577 |
| Molecular Formula | C13H14BrF2N3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccn(C)n1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H14BrF2N3/c1-3-17-13(10-6-7-19(2)18-10)11-9(15)5-4-8(14)12(11)16/h4-7,13,17H,3H2,1-2H3 |
| InChIKey | RPBRDKWLNPIZNP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|