C15H13BrF2IN — CID 106944919
N-[(3-bromo-2,6-difluorophenyl)-(4-iodophenyl)methyl]ethanamine (PubChem CID 106944919) has the molecular formula C15H13BrF2IN and a molecular weight of 452.08 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)-(4-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)-(4-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106944919 |
| Molecular Formula | C15H13BrF2IN |
| Molecular Weight | 452.08 g/mol |
| Exact Mass | 450.92 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)-(4-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)cc1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H13BrF2IN/c1-2-20-15(9-3-5-10(19)6-4-9)13-12(17)8-7-11(16)14(13)18/h3-8,15,20H,2H2,1H3 |
| InChIKey | IALQAVWTQTVKHK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.08 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|