C13H11BrF2INS — CID 106944748
N-[(3-bromo-2,6-difluorophenyl)-(5-iodothiophen-3-yl)methyl]ethanamine (PubChem CID 106944748) has the molecular formula C13H11BrF2INS and a molecular weight of 458.11 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)-(5-iodothiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)-(5-iodothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106944748 |
| Molecular Formula | C13H11BrF2INS |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 456.88 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)-(5-iodothiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1csc(I)c1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H11BrF2INS/c1-2-18-13(7-5-10(17)19-6-7)11-9(15)4-3-8(14)12(11)16/h3-6,13,18H,2H2,1H3 |
| InChIKey | NSRCMNCCAHWJNM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|