C14H12F4INS — CID 107291883
N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(5-iodothiophen-3-yl)methyl]ethanamine (PubChem CID 107291883) has the molecular formula C14H12F4INS and a molecular weight of 429.22 g/mol. Its IUPAC name is N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(5-iodothiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(5-iodothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107291883 |
| Molecular Formula | C14H12F4INS |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(5-iodothiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1csc(I)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F4INS/c1-2-20-13(9-6-12(19)21-7-9)8-3-4-11(15)10(5-8)14(16,17)18/h3-7,13,20H,2H2,1H3 |
| InChIKey | ICXQFVPZBULAHZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|