C14H13F4NS — CID 104991349
1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-(5-methylthiophen-3-yl)methanamine (PubChem CID 104991349) has the molecular formula C14H13F4NS and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-(5-methylthiophen-3-yl)methanamine.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-(5-methylthiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 104991349 |
| Molecular Formula | C14H13F4NS |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-(5-methylthiophen-3-yl)methanamine |
| SMILES | CNC(c1csc(C)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F4NS/c1-8-5-10(7-20-8)13(19-2)9-3-4-12(15)11(6-9)14(16,17)18/h3-7,13,19H,1-2H3 |
| InChIKey | URYVCGLROHZIES-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |