C13H10ClF4NS — CID 80529038
1-(3-chlorothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylmethanamine (PubChem CID 80529038) has the molecular formula C13H10ClF4NS and a molecular weight of 323.74 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 80529038 |
| Molecular Formula | C13H10ClF4NS |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methylmethanamine |
| SMILES | CNC(c1ccc(F)c(C(F)(F)F)c1)c1sccc1Cl |
| InChI | InChI=1S/C13H10ClF4NS/c1-19-11(12-9(14)4-5-20-12)7-2-3-10(15)8(6-7)13(16,17)18/h2-6,11,19H,1H3 |
| InChIKey | NOPCUVOVHSYUMD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |