C14H13ClF3NS — CID 102757874
1-(3-chlorothiophen-2-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 102757874) has the molecular formula C14H13ClF3NS and a molecular weight of 319.78 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102757874 |
| Molecular Formula | C14H13ClF3NS |
| Molecular Weight | 319.78 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | CNC(c1ccc(C(F)(F)F)cc1C)c1sccc1Cl |
| InChI | InChI=1S/C14H13ClF3NS/c1-8-7-9(14(16,17)18)3-4-10(8)12(19-2)13-11(15)5-6-20-13/h3-7,12,19H,1-2H3 |
| InChIKey | LMXFXZDNGFWPSL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.78 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |