C14H14F3NS — CID 55006914
N-methyl-1-(3-methylthiophen-2-yl)-1-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 55006914) has the molecular formula C14H14F3NS and a molecular weight of 285.33 g/mol. Its IUPAC name is N-methyl-1-(3-methylthiophen-2-yl)-1-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-methyl-1-(3-methylthiophen-2-yl)-1-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 55006914 |
| Molecular Formula | C14H14F3NS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-methyl-1-(3-methylthiophen-2-yl)-1-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | CNC(c1ccc(C(F)(F)F)cc1)c1sccc1C |
| InChI | InChI=1S/C14H14F3NS/c1-9-7-8-19-13(9)12(18-2)10-3-5-11(6-4-10)14(15,16)17/h3-8,12,18H,1-2H3 |
| InChIKey | ZJHFARHIXSKOTE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |