C13H12F3NS — CID 43483425
N-methyl-1-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 43483425) has the molecular formula C13H12F3NS and a molecular weight of 271.31 g/mol. Its IUPAC name is N-methyl-1-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-methyl-1-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 43483425 |
| Molecular Formula | C13H12F3NS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-methyl-1-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | CNC(c1ccc(C(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C13H12F3NS/c1-17-12(11-3-2-8-18-11)9-4-6-10(7-5-9)13(14,15)16/h2-8,12,17H,1H3 |
| InChIKey | RCYNRJZCGGEVMA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |